Balancing Complex Chemical Equations: Pb(N₃)₂ + Cr(MnO₄)₂ Reaction Tutorial
Learn how to balance the complex chemical equation Pb(N₃)₂ + Cr(MnO₄)₂ → Cr₂O₃ + MnO₂ + Pb₃O₄ + NO using algebraic methods. This guide walks you through variable assignments for each compound, step-by-step algebraic manipulation, and solving for each unknown to ensure mass balance. With a detailed explanation of how to use the lowest common multiples and radicals, you will gain a deeper understanding of balancing chemical equations effectively. Perfect for chemistry students and educators seeking clarity in chemical reactions.
Balancing Complex Chemical Equations: Pb(N₃)₂ + Cr(MnO₄)₂ Reaction Tutorial
E N D
Presentation Transcript
Algebraic Solving Method Balancing Chemical Equations
Balance This Equation Pb(N3)2 + Cr(MnO4)2 Cr2O3+ MnO2 + Pb3O4 + NO
Pb(N3)2 + Cr(MnO4)2 Cr2O3+ MnO2 + Pb3O4 + NO Let Pb(N3)2 = A Let Cr(MnO4)2 = B Let Cr2O3= C Let MnO2= D Let Pb3O4= E Let NO= F Give Each Compound a Variable
Solve For Each of the Variables Pb(N3)2+Cr(MnO4)2Cr2O3+MnO2+Pb3O4+NO Let A=1 • Pb: A=3E * A is the amount of Pb on the left side of the equation *3E is the amount on the left side
A=1 Pb: A=3E N: 6A=F Cr: B=2C Mn: 2B=D O: 8B=3C+2D+4E+F Substitute in A Pb: 1=3E 1/3=E N: 6x1=F 6=F Cr: B=2C or B/2=C Mn: 2B=D or B=D/2 O: 8B=3C+2D+4E+F 8B=3(B/2)+3(2B)+4(1/3)+6 Solve For Each of the Variables Pb(N3)2+Cr(MnO4)2Cr2O3+MnO2+Pb3O4+NO
Solve for Oxygen O: 8B=3B/2+4B+4/3+6 Find a lowest common multiple of 2 and 3 Multiply each side by 6 [6x] 8B=(3B/2)+(4B+4/3)+6 48B=9B+24B+8+36 48B=33B+44 15B=44
A=1 B=44/15 C=(B/2)x(44/15) C=44/30 D=2B D=(2/1)x(44/15) D=88/15 E=1/3 F=6 Find a GCD and multiply each. A=15 B=44 C=22 D=88 E=5 F=90 Simplify Your Fractions
Now You Have A Finished Equation Substitute each value into the equation. A=15 D=88 B=44 E=5 C=22 F=90 15Pb(N3)2 +44 Cr(MnO4)2 22Cr2O3+ 88MnO2 + 5Pb3O4 +90 NO
This powerpoint was kindly donated to www.worldofteaching.com http://www.worldofteaching.com is home to over a thousand powerpoints submitted by teachers. This is a completely free site and requires no registration. Please visit and I hope it will help in your teaching.