1 / 38

Biochemistry Jeopardy

Biochemistry Jeopardy. Hydrocarbons $10. How many bonds can a carbon atom form with other atoms? 4. Hydrocarbons $20. What are compounds with the same molecular formula, but arranged differently in their structures? isomers. Hydrocarbons $30.

mira
Download Presentation

Biochemistry Jeopardy

An Image/Link below is provided (as is) to download presentation Download Policy: Content on the Website is provided to you AS IS for your information and personal use and may not be sold / licensed / shared on other websites without getting consent from its author. Content is provided to you AS IS for your information and personal use only. Download presentation by click this link. While downloading, if for some reason you are not able to download a presentation, the publisher may have deleted the file from their server. During download, if you can't get a presentation, the file might be deleted by the publisher.

E N D

Presentation Transcript

  1. Biochemistry Jeopardy

  2. Hydrocarbons $10 How many bonds can a carbon atom form with other atoms? 4

  3. Hydrocarbons $20 What are compounds with the same molecular formula, but arranged differently in their structures? isomers

  4. Hydrocarbons $30 What is the removing of water to join monomers called? What is the addition of water to split polymers called? Dehydration synthesis Hydrolysis

  5. Hydrocarbons $40 Match the functional groups: -COOH A. hydroxyl -NH2 B. carboxyl -C=O C. carbonyl -OH D. amino B , D, C, A

  6. Hydrocarbons $50 Identifythe triglyceride, disaccharide, amino acid and the nucleotide.

  7. Carbohydrates $10 What is the monomer of a carbohydrate called? monosaccharide

  8. Carbohydrates $20 Most sugars end in which suffix? Give two examples: -ose -glucose, sucrose, fructose, maltose

  9. Carbohydrates $30 Describe the test used to determine positive results for glucose and what the results would look like: Benedicts heated turns blue to orange-red

  10. Carbohydrates $40 Describe the positive test for starch: what is used and what a positive test looks like. Starch turns iodine from straw yellow to blue-black

  11. Carbohydrates $50 MATCH: 1. Cellulose A. polysacch. - plants 2. Glucose B. fiber from plants 3. Glycogen C. polysacch. - animals 4. Starch D. monosaccharide 5. Sucrose E. disaccharide 1-B 2-D 3-C 4-A 5-E

  12. Lipids $10 Which best describes lipids?A. hydrophilic B. hydrophobic C. ionic D. polar covalent B “water fearing”

  13. Lipids $20 What is the monomer of lipids? Fatty acids and glycerol

  14. Lipids $30 A triglyceride has how many glycerols and how many fatty acids? 1 glycerol (backbone) 3 fatty acids

  15. Lipids $40 What kind of molecules are these lipids? steroids

  16. Lipids $50 MATCH A. Monounsaturated B. Polyunsaturated C. Saturated CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH

  17. Proteins $10 What is the monomer of proteins? Amino acids

  18. Proteins $20 How many different amino acids are there? How are they different? 20 R groups

  19. Protein $30 What does “denaturation” mean? What is a positive test for proteins in the lab? Unravel proteins Biurets turns from blue to purple

  20. Protein $40 Describe how each level of proteins are different:

  21. Protein $50 List and describe the seven types of proteins: Structural, storage, signal hormone, contractile, defensive, enzyme, transport

  22. Nucleic Acids $10 What is the monomer called of nucleic acids? nucleotide

  23. Nucleic Acids $20 What is the name of the element found in nucleic acids that is not found in the other macromolecules? P or phosphorus

  24. Nucleic Acids $30 What is the main job of nucleic acids? Store genetic information

  25. Nucleic Acids $40 List two examples of nucleic acids: DNARNA

  26. Nucleic Acids $50 What are the three parts of nucleic acids? Sugar Phosphates Nitrogenous bases

  27. MISC. $10 Phospholipids, waxes, and steroids are all:A. proteins C. nucleic acids B. fats D. carbohydrates B. fats

  28. MISC. $20 Artherosclerosis (hardening of the arteries) is caused by what: Build-up of LDL’s

  29. Misc. $30 Which is not the same as the other three?A. protein B. amino acid chain C. polyunsaturate D. polypeptide polyunsaturate

  30. Misc. $40 What is the name of the bond that holds together:A. proteins B. nucleic acids A. Peptide B. hydrogen

  31. Misc. $50 What is: 1. shape of DNA 2. name of diff. part of amino acids 3. positive test for fats • Helical • R group • Translucence on brown paper

  32. BONUS: Which is a monosaccharide and which is a disaccharide? Disaccharide Monosaccharide

  33. Carbos H:O 2:1 Fats H:O Greater than twice as many H as O How can you tell fats from carbos? CH3(CH2)10CO2H CH3(CH2)4(CH=CHCH2)4(CH2)2CO2H

  34. Glycogen Cellulose Starch Liver and muscles in animals Cell walls of plants Plants (nuts, potatoes, etc.) Where is this polysaccharide stored?

  35. What if starch underwent hydrolysis, what monomer would form? What test could you do to be sure that is what it is? • Glucose • Benedicts blue to orange-red

  36. Most common carbohydrate in the world? • A. glucose • B. cellulose • C. starch • D. phospholipid • ANSWER: cellulose

  37. 1. Made of 2 or more polypeptides B. Coiled or pleated C. Folded on itself(3-D globular or fibrous) 4. Sequence of Amino Acids A. Primary B. Secondary C. Tertiary D. Quaternary ANSWERS: 1-D, 2-B, 3-C, 4-A Match the protein structure:

  38. What two elements are hydrocrbons made of? • Carbon and hydrogen • Nitrogen and carbon • Oxygen and carbon • Hydrogen and oxygen • ANSWER: hydrogen and carbon

More Related