390 likes | 610 Views
Biochemistry Jeopardy. Hydrocarbons $10. How many bonds can a carbon atom form with other atoms? 4. Hydrocarbons $20. What are compounds with the same molecular formula, but arranged differently in their structures? isomers. Hydrocarbons $30.
E N D
Hydrocarbons $10 How many bonds can a carbon atom form with other atoms? 4
Hydrocarbons $20 What are compounds with the same molecular formula, but arranged differently in their structures? isomers
Hydrocarbons $30 What is the removing of water to join monomers called? What is the addition of water to split polymers called? Dehydration synthesis Hydrolysis
Hydrocarbons $40 Match the functional groups: -COOH A. hydroxyl -NH2 B. carboxyl -C=O C. carbonyl -OH D. amino B , D, C, A
Hydrocarbons $50 Identifythe triglyceride, disaccharide, amino acid and the nucleotide.
Carbohydrates $10 What is the monomer of a carbohydrate called? monosaccharide
Carbohydrates $20 Most sugars end in which suffix? Give two examples: -ose -glucose, sucrose, fructose, maltose
Carbohydrates $30 Describe the test used to determine positive results for glucose and what the results would look like: Benedicts heated turns blue to orange-red
Carbohydrates $40 Describe the positive test for starch: what is used and what a positive test looks like. Starch turns iodine from straw yellow to blue-black
Carbohydrates $50 MATCH: 1. Cellulose A. polysacch. - plants 2. Glucose B. fiber from plants 3. Glycogen C. polysacch. - animals 4. Starch D. monosaccharide 5. Sucrose E. disaccharide 1-B 2-D 3-C 4-A 5-E
Lipids $10 Which best describes lipids?A. hydrophilic B. hydrophobic C. ionic D. polar covalent B “water fearing”
Lipids $20 What is the monomer of lipids? Fatty acids and glycerol
Lipids $30 A triglyceride has how many glycerols and how many fatty acids? 1 glycerol (backbone) 3 fatty acids
Lipids $40 What kind of molecules are these lipids? steroids
Lipids $50 MATCH A. Monounsaturated B. Polyunsaturated C. Saturated CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH
Proteins $10 What is the monomer of proteins? Amino acids
Proteins $20 How many different amino acids are there? How are they different? 20 R groups
Protein $30 What does “denaturation” mean? What is a positive test for proteins in the lab? Unravel proteins Biurets turns from blue to purple
Protein $40 Describe how each level of proteins are different:
Protein $50 List and describe the seven types of proteins: Structural, storage, signal hormone, contractile, defensive, enzyme, transport
Nucleic Acids $10 What is the monomer called of nucleic acids? nucleotide
Nucleic Acids $20 What is the name of the element found in nucleic acids that is not found in the other macromolecules? P or phosphorus
Nucleic Acids $30 What is the main job of nucleic acids? Store genetic information
Nucleic Acids $40 List two examples of nucleic acids: DNARNA
Nucleic Acids $50 What are the three parts of nucleic acids? Sugar Phosphates Nitrogenous bases
MISC. $10 Phospholipids, waxes, and steroids are all:A. proteins C. nucleic acids B. fats D. carbohydrates B. fats
MISC. $20 Artherosclerosis (hardening of the arteries) is caused by what: Build-up of LDL’s
Misc. $30 Which is not the same as the other three?A. protein B. amino acid chain C. polyunsaturate D. polypeptide polyunsaturate
Misc. $40 What is the name of the bond that holds together:A. proteins B. nucleic acids A. Peptide B. hydrogen
Misc. $50 What is: 1. shape of DNA 2. name of diff. part of amino acids 3. positive test for fats • Helical • R group • Translucence on brown paper
BONUS: Which is a monosaccharide and which is a disaccharide? Disaccharide Monosaccharide
Carbos H:O 2:1 Fats H:O Greater than twice as many H as O How can you tell fats from carbos? CH3(CH2)10CO2H CH3(CH2)4(CH=CHCH2)4(CH2)2CO2H
Glycogen Cellulose Starch Liver and muscles in animals Cell walls of plants Plants (nuts, potatoes, etc.) Where is this polysaccharide stored?
What if starch underwent hydrolysis, what monomer would form? What test could you do to be sure that is what it is? • Glucose • Benedicts blue to orange-red
Most common carbohydrate in the world? • A. glucose • B. cellulose • C. starch • D. phospholipid • ANSWER: cellulose
1. Made of 2 or more polypeptides B. Coiled or pleated C. Folded on itself(3-D globular or fibrous) 4. Sequence of Amino Acids A. Primary B. Secondary C. Tertiary D. Quaternary ANSWERS: 1-D, 2-B, 3-C, 4-A Match the protein structure:
What two elements are hydrocrbons made of? • Carbon and hydrogen • Nitrogen and carbon • Oxygen and carbon • Hydrogen and oxygen • ANSWER: hydrogen and carbon