30 likes | 328 Views
Name ____________________ Score /30. (What type of alcohol is this? Explain) 1 o 2 o 3 o. (N) 2. CH 2 OHCH(CH 3 )CH 3. (N) 1. CH 2 ClCHClCH 2 CH 3. (MF) 4. 3-ethyl-2,4-dimethylhexane. (SCF) 3. 2,3-difluoropentane. (N) 6. CH 3 CH 2 CH 2 OCH 2 CH 3.
E N D
Name ____________________ Score /30 (What type of alcohol is this? Explain) 1o 2o 3o (N) 2. CH2OHCH(CH3)CH3 (N) 1. CH2ClCHClCH2CH3 (MF) 4. 3-ethyl-2,4-dimethylhexane (SCF) 3. 2,3-difluoropentane (N) 6. CH3CH2CH2OCH2CH3 (MF) 5. 2-pentyne 7. 3-propylheptane is a structural isomer of which straight chain alkane? (N) 8. CH3C≡CCH2CH3 9. Draw shorthand of 3-methyl-2-hexene H H H H Cl H H H (N) 10. CH3CH2CH2CH(CH2CH3)CH2CHO (it’s NOT an –OH) (N) 11. C-C-C-C-C-C-C-C=O H H H H H H Cl H (N) 12. CH3(CH2)3COOH N = IUPAC Name CSF = condensed structural formula DSF = draw structural formula
H3C OH Br Cl Draw out structural formula for questions #13-17 (include ALL hydrogens or provide a molecular formula). 13. 4-ethyl hex(2)enoic acid 14. 3,3,5-triiodo-2-heptanone 15. butyl pentanoate 16. 1,2,3-propantriol 17. CH3-CH2-NH-CH3 What is the correct name of the following: O = 18. CH3 – C – O – CH2 – CH2 – CH2 – CH2 – CH319. 20.
1. 1,2-dichlorobutane 2. 2-methyl-1-propanol (1o alcohol) 3. CH3CHFCHFCH2CH3 or CH3(CHF)2CH2CH3 4. C10H20 5. C5H10 6. ethoxypropane (common name…ethyl-propyl ether) 7. decane 8. 2-pentyne 9. 10. 4-ethylhexanal 11. 3,4-dichlorooctanal 12. pentanoic acid 13. 14. 15. 16. 17. ethyl methyl amine 19. pentyl ethanoate 20. 2-methyl phenol m-methyl phenol 18. 4-bromo-3-chloro-5-propyl nonane H O H H H I I . C-C-C-C-C-C-C- H H H H O H H C-C-C-C=C-C-OH H H H H H H I H H H CH3CH2CH(CH2CH3)CHCHCOOH H C H CH3COCI2CH2CHICH2CH3 C H H H H O H H H H H H O H H H H HO -C-C-C- OH C-C-C-C-C-O-C-C-C-C-H H H H H H H H H H H H H CH2OHCHOHCH2OH CH3CH2CH2CH2COOCH2CH2CH2CH3